C17H26O4 — CID 14465194
methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4,5-dimethylidene-1,3,6,6a-tetrahydropentalen-3a-yl]acetate (PubChem CID 14465194) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4,5-dimethylidene-1,3,6,6a-tetrahydropentalen-3a-yl]acetate.
| Compound Name | methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4,5-dimethylidene-1,3,6,6a-tetrahydropentalen-3a-yl]acetate |
|---|---|
| PubChem CID | 14465194 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 2-[(1R,3aR,6aS)-1-(methoxymethoxy)-2,2-dimethyl-4,5-dimethylidene-1,3,6,6a-tetrahydropentalen-3a-yl]acetate |
| SMILES | C=C1C[C@@H]2[C@@H](OCOC)C(C)(C)C[C@]2(CC(=O)OC)C1=C |
| InChI | InChI=1S/C17H26O4/c1-11-7-13-15(21-10-19-5)16(3,4)9-17(13,12(11)2)8-14(18)20-6/h13,15H,1-2,7-10H2,3-6H3/t13-,15-,17-/m1/s1 |
| InChIKey | YEDXEACIQZZZPH-FRFSOERESA-N |
| XLogP | 3.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|