About ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene
ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene (PubChem CID 144652064) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene.
Molecular Properties
| Compound Name | ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene |
| PubChem CID | 144652064 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene |
| SMILES | C=CC(C)/C=C\C1=C(C)CCC1.CC |
| InChI | InChI=1S/C12H18.C2H6/c1-4-10(2)8-9-12-7-5-6-11(12)3;1-2/h4,8-10H,1,5-7H2,2-3H3;1-2H3/b9-8-; |
| InChIKey | XQWVWEUZKPJMLS-UOQXYWCXSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene?
The IUPAC name of ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene (CID 144652064) is ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene.
What is the SMILES notation for ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene?
The canonical SMILES for ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene is C=CC(C)/C=C\C1=C(C)CCC1.CC.
What is the InChIKey of ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene?
The InChIKey is XQWVWEUZKPJMLS-UOQXYWCXSA-N. The full InChI is InChI=1S/C12H18.C2H6/c1-4-10(2)8-9-12-7-5-6-11(12)3;1-2/h4,8-10H,1,5-7H2,2-3H3;1-2H3/b9-8-;.
What are the key properties of ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene?
ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene has a molecular weight of 192.35 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2-[(1Z)-3-methylpenta-1,4-dienyl]cyclopentene is sourced from PubChem (CID 144652064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).