C26H38O11 — CID 144652638
(2R,5S)-2-[(E)-3-[2,5-dimethoxy-4-[(E)-3-[(2R,3S,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-1-enyl]phenyl]prop-2-enyl]-6-methyloxane-3,4,5-triol (PubChem CID 144652638) has the molecular formula C26H38O11 and a molecular weight of 526.58 g/mol. Its IUPAC name is (2R,5S)-2-[(E)-3-[2,5-dimethoxy-4-[(E)-3-[(2R,3S,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-1-enyl]phenyl]prop-2-enyl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,5S)-2-[(E)-3-[2,5-dimethoxy-4-[(E)-3-[(2R,3S,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-1-enyl]phenyl]prop-2-enyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 144652638 |
| Molecular Formula | C26H38O11 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (2R,5S)-2-[(E)-3-[2,5-dimethoxy-4-[(E)-3-[(2R,3S,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-1-enyl]phenyl]prop-2-enyl]-6-methyloxane-3,4,5-triol |
| SMILES | COc1cc(/C=C/C[C@H]2O[C@H](CO)C(O)[C@H](O)[C@@H]2O)c(OC)cc1/C=C/C[C@H]1OC(C)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C26H38O11/c1-13-21(28)25(32)22(29)16(36-13)8-4-6-14-10-19(35-3)15(11-18(14)34-2)7-5-9-17-23(30)26(33)24(31)20(12-27)37-17/h4-7,10-11,13,16-17,20-33H,8-9,12H2,1-3H3/b6-4+,7-5+/t13?,16-,17-,20-,21-,22?,23-,24?,25?,26-/m1/s1 |
| InChIKey | RBPGTAYHZLKQAZ-GDFHQPERSA-N |
| XLogP | -0.78 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |