C17H35NO3 — CID 144652681
ethane;3-methyl-3-(2-methylpropyl)oxetane;4-methylpiperidine-1-carboxylic acid (PubChem CID 144652681) has the molecular formula C17H35NO3 and a molecular weight of 301.47 g/mol. Its IUPAC name is ethane;3-methyl-3-(2-methylpropyl)oxetane;4-methylpiperidine-1-carboxylic acid.
| Compound Name | ethane;3-methyl-3-(2-methylpropyl)oxetane;4-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 144652681 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | ethane;3-methyl-3-(2-methylpropyl)oxetane;4-methylpiperidine-1-carboxylic acid |
| SMILES | CC.CC(C)CC1(C)COC1.CC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C8H16O.C7H13NO2.C2H6/c1-7(2)4-8(3)5-9-6-8;1-6-2-4-8(5-3-6)7(9)10;1-2/h7H,4-6H2,1-3H3;6H,2-5H2,1H3,(H,9,10);1-2H3 |
| InChIKey | FPGRDZJBGWQXRY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |