C15H23NO7 — CID 144652900
[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-amino-6-prop-2-enyloxan-2-yl]methyl acetate (PubChem CID 144652900) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-amino-6-prop-2-enyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-amino-6-prop-2-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 144652900 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4,5-diacetyloxy-3-amino-6-prop-2-enyloxan-2-yl]methyl acetate |
| SMILES | C=CC[C@H]1O[C@H](COC(C)=O)[C@@H](N)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H23NO7/c1-5-6-11-14(21-9(3)18)15(22-10(4)19)13(16)12(23-11)7-20-8(2)17/h5,11-15H,1,6-7,16H2,2-4H3/t11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | RCBMATXBHVPULX-RYPNDVFKSA-N |
| XLogP | 0.08 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|