About 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide
1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide (PubChem CID 144653183) has the molecular formula C7H11F3N2O
and a molecular weight of 196.17 g/mol. Its IUPAC name is 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
| PubChem CID | 144653183 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
| SMILES | CNC1(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C7H11F3N2O/c1-11-6(2-3-6)5(13)12-4-7(8,9)10/h11H,2-4H2,1H3,(H,12,13) |
| InChIKey | CWYXFQVTYUHBOP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide?
The IUPAC name of 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide (CID 144653183) is 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide.
What is the SMILES notation for 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide?
The canonical SMILES for 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide is CNC1(C(=O)NCC(F)(F)F)CC1.
What is the InChIKey of 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide?
The InChIKey is CWYXFQVTYUHBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2O/c1-11-6(2-3-6)5(13)12-4-7(8,9)10/h11H,2-4H2,1H3,(H,12,13).
What are the key properties of 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide?
1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide has a molecular weight of 196.17 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 144653183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).