C18H18ClF3N2 — CID 144653516
[4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]hydrazine (PubChem CID 144653516) has the molecular formula C18H18ClF3N2 and a molecular weight of 354.80 g/mol. Its IUPAC name is [4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]hydrazine.
| Compound Name | [4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 144653516 |
| Molecular Formula | C18H18ClF3N2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]hydrazine |
| SMILES | Cc1cc(C(/C=C/c2ccc(NN)cc2)C(F)(F)F)cc(Cl)c1C |
| InChI | InChI=1S/C18H18ClF3N2/c1-11-9-14(10-17(19)12(11)2)16(18(20,21)22)8-5-13-3-6-15(24-23)7-4-13/h3-10,16,24H,23H2,1-2H3/b8-5+ |
| InChIKey | HYQFFVPFIVJERH-VMPITWQZSA-N |
| XLogP | 5.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|