C21H36O2 — CID 144653690
(4S,6S)-6-[(1E,3E)-5-[(2S,3S,6R)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-2,2,4-trimethyloxane (PubChem CID 144653690) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (4S,6S)-6-[(1E,3E)-5-[(2S,3S,6R)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-2,2,4-trimethyloxane.
| Compound Name | (4S,6S)-6-[(1E,3E)-5-[(2S,3S,6R)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-2,2,4-trimethyloxane |
|---|---|
| PubChem CID | 144653690 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (4S,6S)-6-[(1E,3E)-5-[(2S,3S,6R)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-2,2,4-trimethyloxane |
| SMILES | CC(/C=C/[C@@H]1C[C@H](C)CC(C)(C)O1)=C\C[C@@H]1O[C@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C21H36O2/c1-15(8-12-20-17(3)9-10-18(4)22-20)7-11-19-13-16(2)14-21(5,6)23-19/h7-8,11,16-20H,9-10,12-14H2,1-6H3/b11-7+,15-8+/t16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | GDRWZNFYQRSMNW-XICVZZBYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|