About 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile
3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile (PubChem CID 144653753) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile |
| PubChem CID | 144653753 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile |
| SMILES | CC1(C)CC=CC=C2N=CC(N)=C(C#N)C21 |
| InChI | InChI=1S/C13H15N3/c1-13(2)6-4-3-5-11-12(13)9(7-14)10(15)8-16-11/h3-5,8,12H,6,15H2,1-2H3 |
| InChIKey | GXADXFQLMCXBBV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile?
The IUPAC name of 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile (CID 144653753) is 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile.
What is the SMILES notation for 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile?
The canonical SMILES for 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile is CC1(C)CC=CC=C2N=CC(N)=C(C#N)C21.
What is the InChIKey of 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile?
The InChIKey is GXADXFQLMCXBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3/c1-13(2)6-4-3-5-11-12(13)9(7-14)10(15)8-16-11/h3-5,8,12H,6,15H2,1-2H3.
What are the key properties of 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile?
3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile has a molecular weight of 213.28 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,5-dimethyl-4a,6-dihydrocyclohepta[b]pyridine-4-carbonitrile is sourced from PubChem (CID 144653753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).