C15H27N3 — CID 144654075
N,N'-dimethyl-N'-[(3E)-3-piperidin-1-ylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine (PubChem CID 144654075) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[(3E)-3-piperidin-1-ylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N'-[(3E)-3-piperidin-1-ylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 144654075 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,N'-dimethyl-N'-[(3E)-3-piperidin-1-ylhexa-1,3,5-trien-2-yl]ethane-1,2-diamine |
| SMILES | C=C/C=C(\C(=C)N(C)CCNC)N1CCCCC1 |
| InChI | InChI=1S/C15H27N3/c1-5-9-15(18-11-7-6-8-12-18)14(2)17(4)13-10-16-3/h5,9,16H,1-2,6-8,10-13H2,3-4H3/b15-9+ |
| InChIKey | DIKCWPLQHYHPEY-OQLLNIDSSA-N |
| XLogP | 2.21 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|