About ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine
ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine (PubChem CID 144654673) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine.
Molecular Properties
| Compound Name | ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine |
| PubChem CID | 144654673 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine |
| SMILES | C=N/C=C(\C=C/C)C(C)N(C)C1CCCCC1.CC |
| InChI | InChI=1S/C15H26N2.C2H6/c1-5-9-14(12-16-3)13(2)17(4)15-10-7-6-8-11-15;1-2/h5,9,12-13,15H,3,6-8,10-11H2,1-2,4H3;1-2H3/b9-5-,14-12+; |
| InChIKey | AMJLBUKADGYAGL-OMLGCRDASA-N |
| XLogP | 4.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine?
The IUPAC name of ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine (CID 144654673) is ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine.
What is the SMILES notation for ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine?
The canonical SMILES for ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine is C=N/C=C(\C=C/C)C(C)N(C)C1CCCCC1.CC.
What is the InChIKey of ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine?
The InChIKey is AMJLBUKADGYAGL-OMLGCRDASA-N. The full InChI is InChI=1S/C15H26N2.C2H6/c1-5-9-14(12-16-3)13(2)17(4)15-10-7-6-8-11-15;1-2/h5,9,12-13,15H,3,6-8,10-11H2,1-2,4H3;1-2H3/b9-5-,14-12+;.
What are the key properties of ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine?
ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine has a molecular weight of 264.46 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-N-[(Z,3E)-3-[(methylideneamino)methylidene]hex-4-en-2-yl]cyclohexanamine is sourced from PubChem (CID 144654673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).