About ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide
ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide (PubChem CID 144654887) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide.
Molecular Properties
| Compound Name | ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide |
| PubChem CID | 144654887 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide |
| SMILES | CC.CC(=O)NCc1c(-c2nccs2)[nH]c(C)cc1=O |
| InChI | InChI=1S/C12H13N3O2S.C2H6/c1-7-5-10(17)9(6-14-8(2)16)11(15-7)12-13-3-4-18-12;1-2/h3-5H,6H2,1-2H3,(H,14,16)(H,15,17);1-2H3 |
| InChIKey | RXLRMUHQCUXZBR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide?
The IUPAC name of ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide (CID 144654887) is ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide.
What is the SMILES notation for ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide?
The canonical SMILES for ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide is CC.CC(=O)NCc1c(-c2nccs2)[nH]c(C)cc1=O.
What is the InChIKey of ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide?
The InChIKey is RXLRMUHQCUXZBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S.C2H6/c1-7-5-10(17)9(6-14-8(2)16)11(15-7)12-13-3-4-18-12;1-2/h3-5H,6H2,1-2H3,(H,14,16)(H,15,17);1-2H3.
What are the key properties of ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide?
ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide has a molecular weight of 293.39 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[[6-methyl-4-oxo-2-(1,3-thiazol-2-yl)-1H-pyridin-3-yl]methyl]acetamide is sourced from PubChem (CID 144654887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).