About ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone
ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone (PubChem CID 144654976) has the molecular formula C15H22N4O
and a molecular weight of 274.37 g/mol. Its IUPAC name is ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone |
| PubChem CID | 144654976 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone |
| SMILES | CC.Cc1ncc2ccn(CC(=O)N3CCCC3)c2n1 |
| InChI | InChI=1S/C13H16N4O.C2H6/c1-10-14-8-11-4-7-17(13(11)15-10)9-12(18)16-5-2-3-6-16;1-2/h4,7-8H,2-3,5-6,9H2,1H3;1-2H3 |
| InChIKey | XTVKGRZTPOVQRI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone?
The IUPAC name of ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone (CID 144654976) is ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone.
What is the SMILES notation for ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone?
The canonical SMILES for ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone is CC.Cc1ncc2ccn(CC(=O)N3CCCC3)c2n1.
What is the InChIKey of ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone?
The InChIKey is XTVKGRZTPOVQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O.C2H6/c1-10-14-8-11-4-7-17(13(11)15-10)9-12(18)16-5-2-3-6-16;1-2/h4,7-8H,2-3,5-6,9H2,1H3;1-2H3.
What are the key properties of ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone?
ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone has a molecular weight of 274.37 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 144654976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).