C29H37N3O — CID 144655011
1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[4-(ethylideneamino)-3-methylphenyl]anilino]propan-2-ol;ethane (PubChem CID 144655011) has the molecular formula C29H37N3O and a molecular weight of 443.64 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[4-(ethylideneamino)-3-methylphenyl]anilino]propan-2-ol;ethane.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[4-(ethylideneamino)-3-methylphenyl]anilino]propan-2-ol;ethane |
|---|---|
| PubChem CID | 144655011 |
| Molecular Formula | C29H37N3O |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[4-(ethylideneamino)-3-methylphenyl]anilino]propan-2-ol;ethane |
| SMILES | C/C=N/c1ccc(-c2cccc(NCC(O)CN3CCc4ccccc4C3)c2)cc1C.CC |
| InChI | InChI=1S/C27H31N3O.C2H6/c1-3-28-27-12-11-23(15-20(27)2)22-9-6-10-25(16-22)29-17-26(31)19-30-14-13-21-7-4-5-8-24(21)18-30;1-2/h3-12,15-16,26,29,31H,13-14,17-19H2,1-2H3;1-2H3/b28-3+; |
| InChIKey | KOSQDEFQQCQCFM-HJQBTBMNSA-N |
| XLogP | 6.24 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|