C25H44N6OS — CID 144655188
N,N'-dimethyl-N'-phenylsulfanylethane-1,2-diamine;methanamine;N-(2-piperidin-3-ylphenyl)acetamide (PubChem CID 144655188) has the molecular formula C25H44N6OS and a molecular weight of 476.74 g/mol. Its IUPAC name is N,N'-dimethyl-N'-phenylsulfanylethane-1,2-diamine;methanamine;N-(2-piperidin-3-ylphenyl)acetamide.
| Compound Name | N,N'-dimethyl-N'-phenylsulfanylethane-1,2-diamine;methanamine;N-(2-piperidin-3-ylphenyl)acetamide |
|---|---|
| PubChem CID | 144655188 |
| Molecular Formula | C25H44N6OS |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | N,N'-dimethyl-N'-phenylsulfanylethane-1,2-diamine;methanamine;N-(2-piperidin-3-ylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccccc1C1CCCNC1.CN.CN.CNCCN(C)Sc1ccccc1 |
| InChI | InChI=1S/C13H18N2O.C10H16N2S.2CH5N/c1-10(16)15-13-7-3-2-6-12(13)11-5-4-8-14-9-11;1-11-8-9-12(2)13-10-6-4-3-5-7-10;2*1-2/h2-3,6-7,11,14H,4-5,8-9H2,1H3,(H,15,16);3-7,11H,8-9H2,1-2H3;2*2H2,1H3 |
| InChIKey | KBSURMKZHPGROX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|