C16H26N2O — CID 144655325
ethane;1-[4-(3-methylanilino)piperidin-1-yl]ethanone (PubChem CID 144655325) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is ethane;1-[4-(3-methylanilino)piperidin-1-yl]ethanone.
| Compound Name | ethane;1-[4-(3-methylanilino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 144655325 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | ethane;1-[4-(3-methylanilino)piperidin-1-yl]ethanone |
| SMILES | CC.CC(=O)N1CCC(Nc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C14H20N2O.C2H6/c1-11-4-3-5-14(10-11)15-13-6-8-16(9-7-13)12(2)17;1-2/h3-5,10,13,15H,6-9H2,1-2H3;1-2H3 |
| InChIKey | QCGLHVVPYFJPTB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |