About ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine
ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine (PubChem CID 144655612) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine |
| PubChem CID | 144655612 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine |
| SMILES | CC.CC.Cc1occ2ncncc12.Cn1cc2cncnc2c1 |
| InChI | InChI=1S/C7H7N3.C7H6N2O.2C2H6/c1-10-3-6-2-8-5-9-7(6)4-10;1-5-6-2-8-4-9-7(6)3-10-5;2*1-2/h2-5H,1H3;2-4H,1H3;2*1-2H3 |
| InChIKey | ZAEUAWFLBRYLJA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine?
The IUPAC name of ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine (CID 144655612) is ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine?
The canonical SMILES for ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine is CC.CC.Cc1occ2ncncc12.Cn1cc2cncnc2c1.
What is the InChIKey of ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine?
The InChIKey is ZAEUAWFLBRYLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C7H6N2O.2C2H6/c1-10-3-6-2-8-5-9-7(6)4-10;1-5-6-2-8-4-9-7(6)3-10-5;2*1-2/h2-5H,1H3;2-4H,1H3;2*1-2H3.
What are the key properties of ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine?
ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine has a molecular weight of 327.43 g/mol, XLogP of 4.55, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylfuro[3,4-d]pyrimidine;6-methylpyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 144655612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).