About 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane
3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane (PubChem CID 144655779) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane.
Molecular Properties
| Compound Name | 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane |
| PubChem CID | 144655779 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane |
| SMILES | CC.Cc1ncc(N)n1/C=C\N |
| InChI | InChI=1S/C6H10N4.C2H6/c1-5-9-4-6(8)10(5)3-2-7;1-2/h2-4H,7-8H2,1H3;1-2H3/b3-2-; |
| InChIKey | FKOQNEVCQNPKOD-OLGQORCHSA-N |
| XLogP | 1.19 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane?
The IUPAC name of 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane (CID 144655779) is 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane.
What is the SMILES notation for 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane?
The canonical SMILES for 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane is CC.Cc1ncc(N)n1/C=C\N.
What is the InChIKey of 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane?
The InChIKey is FKOQNEVCQNPKOD-OLGQORCHSA-N. The full InChI is InChI=1S/C6H10N4.C2H6/c1-5-9-4-6(8)10(5)3-2-7;1-2/h2-4H,7-8H2,1H3;1-2H3/b3-2-;.
What are the key properties of 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane?
3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane has a molecular weight of 168.24 g/mol, XLogP of 1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-aminoethenyl]-2-methylimidazol-4-amine;ethane is sourced from PubChem (CID 144655779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).