About 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol
2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol (PubChem CID 144655815) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol |
| PubChem CID | 144655815 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol |
| SMILES | C=C/C=C(\C=C)OC1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H21NO2/c1-3-5-12(4-2)16-13-6-8-14(9-7-13)10-11-15/h3-5,13,15H,1-2,6-11H2/b12-5+ |
| InChIKey | BVUIAKOFKNFTQT-LFYBBSHMSA-N |
| XLogP | 1.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol?
The IUPAC name of 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol (CID 144655815) is 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol?
The canonical SMILES for 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol is C=C/C=C(\C=C)OC1CCN(CCO)CC1.
What is the InChIKey of 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol?
The InChIKey is BVUIAKOFKNFTQT-LFYBBSHMSA-N. The full InChI is InChI=1S/C13H21NO2/c1-3-5-12(4-2)16-13-6-8-14(9-7-13)10-11-15/h3-5,13,15H,1-2,6-11H2/b12-5+.
What are the key properties of 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol?
2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol has a molecular weight of 223.32 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethanol is sourced from PubChem (CID 144655815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).