About 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine
3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine (PubChem CID 144656254) has the molecular formula C15H23F2N3
and a molecular weight of 283.37 g/mol. Its IUPAC name is 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine.
Molecular Properties
| Compound Name | 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine |
| PubChem CID | 144656254 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine |
| SMILES | CC.CC.Cc1cnccn1.Cc1ncc(F)cc1F |
| InChI | InChI=1S/C6H5F2N.C5H6N2.2C2H6/c1-4-6(8)2-5(7)3-9-4;1-5-4-6-2-3-7-5;2*1-2/h2-3H,1H3;2-4H,1H3;2*1-2H3 |
| InChIKey | LETLAHRYZBRGCX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine?
The IUPAC name of 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine (CID 144656254) is 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine.
What is the SMILES notation for 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine?
The canonical SMILES for 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine is CC.CC.Cc1cnccn1.Cc1ncc(F)cc1F.
What is the InChIKey of 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine?
The InChIKey is LETLAHRYZBRGCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2N.C5H6N2.2C2H6/c1-4-6(8)2-5(7)3-9-4;1-5-4-6-2-3-7-5;2*1-2/h2-3H,1H3;2-4H,1H3;2*1-2H3.
What are the key properties of 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine?
3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine has a molecular weight of 283.37 g/mol, XLogP of 4.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-2-methylpyridine;ethane;2-methylpyrazine is sourced from PubChem (CID 144656254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).