C29H28ClN7O — CID 144656288
2-[1-[[6-amino-5-[2-(6-methyl-2-pyridinyl)ethynyl]pyrimidin-4-yl]amino]ethyl]-5-chloro-3-[(3E,5Z)-hepta-3,5-dien-3-yl]quinazolin-4-one (PubChem CID 144656288) has the molecular formula C29H28ClN7O and a molecular weight of 526.04 g/mol. Its IUPAC name is 2-[1-[[6-amino-5-[2-(6-methyl-2-pyridinyl)ethynyl]pyrimidin-4-yl]amino]ethyl]-5-chloro-3-[(3E,5Z)-hepta-3,5-dien-3-yl]quinazolin-4-one.
| Compound Name | 2-[1-[[6-amino-5-[2-(6-methyl-2-pyridinyl)ethynyl]pyrimidin-4-yl]amino]ethyl]-5-chloro-3-[(3E,5Z)-hepta-3,5-dien-3-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 144656288 |
| Molecular Formula | C29H28ClN7O |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 2-[1-[[6-amino-5-[2-(6-methyl-2-pyridinyl)ethynyl]pyrimidin-4-yl]amino]ethyl]-5-chloro-3-[(3E,5Z)-hepta-3,5-dien-3-yl]quinazolin-4-one |
| SMILES | C/C=C\C=C(/CC)n1c(C(C)Nc2ncnc(N)c2C#Cc2cccc(C)n2)nc2cccc(Cl)c2c1=O |
| InChI | InChI=1S/C29H28ClN7O/c1-5-7-12-21(6-2)37-28(36-24-14-9-13-23(30)25(24)29(37)38)19(4)35-27-22(26(31)32-17-33-27)16-15-20-11-8-10-18(3)34-20/h5,7-14,17,19H,6H2,1-4H3,(H3,31,32,33,35)/b7-5-,21-12+ |
| InChIKey | PJBOEXZXUDVBLP-JWZOAJKYSA-N |
| XLogP | 5.53 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|