C15H18N2OS — CID 144656825
2,4-dimethyl-5-(4-methylphenyl)sulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 144656825) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2,4-dimethyl-5-(4-methylphenyl)sulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | 2,4-dimethyl-5-(4-methylphenyl)sulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 144656825 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2,4-dimethyl-5-(4-methylphenyl)sulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | Cc1ccc(SN2CCc3nc(C)oc3C2C)cc1 |
| InChI | InChI=1S/C15H18N2OS/c1-10-4-6-13(7-5-10)19-17-9-8-14-15(11(17)2)18-12(3)16-14/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | NGOQCJRQXNRROQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|