C8H10N2 — CID 144657023
6-methyl-1,2-dihydropyrrolo[2,3-c]pyridine (PubChem CID 144657023) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-methyl-1,2-dihydropyrrolo[2,3-c]pyridine.
| Compound Name | 6-methyl-1,2-dihydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 144657023 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 6-methyl-1,2-dihydropyrrolo[2,3-c]pyridine |
| SMILES | CN1C=CC2=CCNC2=C1 |
| InChI | InChI=1S/C8H10N2/c1-10-5-3-7-2-4-9-8(7)6-10/h2-3,5-6,9H,4H2,1H3 |
| InChIKey | MKOIJTLFUHSPNJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |