About 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid
1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid (PubChem CID 144658108) has the molecular formula C21H19N3O6
and a molecular weight of 409.40 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid.
Molecular Properties
| Compound Name | 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid |
| PubChem CID | 144658108 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid |
| SMILES | CCNC(=O)c1c(O)c2ccccc2n(OCc2ccc(C#N)cc2)c1=O.O=CO |
| InChI | InChI=1S/C20H17N3O4.CH2O2/c1-2-22-19(25)17-18(24)15-5-3-4-6-16(15)23(20(17)26)27-12-14-9-7-13(11-21)8-10-14;2-1-3/h3-10,24H,2,12H2,1H3,(H,22,25);1H,(H,2,3) |
| InChIKey | ICQLLWAQTMFWLV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid?
The IUPAC name of 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid (CID 144658108) is 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid.
What is the SMILES notation for 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid?
The canonical SMILES for 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid is CCNC(=O)c1c(O)c2ccccc2n(OCc2ccc(C#N)cc2)c1=O.O=CO.
What is the InChIKey of 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid?
The InChIKey is ICQLLWAQTMFWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4.CH2O2/c1-2-22-19(25)17-18(24)15-5-3-4-6-16(15)23(20(17)26)27-12-14-9-7-13(11-21)8-10-14;2-1-3/h3-10,24H,2,12H2,1H3,(H,22,25);1H,(H,2,3).
What are the key properties of 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid?
1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid has a molecular weight of 409.40 g/mol, XLogP of 1.66, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-cyanophenyl)methoxy]-N-ethyl-4-hydroxy-2-oxoquinoline-3-carboxamide;formic acid is sourced from PubChem (CID 144658108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).