C15H25ClN6 — CID 144658204
3-N-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3-N,4-dimethylpiperidine-1,3-diamine;ethane (PubChem CID 144658204) has the molecular formula C15H25ClN6 and a molecular weight of 324.86 g/mol. Its IUPAC name is 3-N-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3-N,4-dimethylpiperidine-1,3-diamine;ethane.
| Compound Name | 3-N-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3-N,4-dimethylpiperidine-1,3-diamine;ethane |
|---|---|
| PubChem CID | 144658204 |
| Molecular Formula | C15H25ClN6 |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-N-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3-N,4-dimethylpiperidine-1,3-diamine;ethane |
| SMILES | CC.CC1CCN(N)CC1N(C)c1nc(Cl)nc2[nH]ccc12 |
| InChI | InChI=1S/C13H19ClN6.C2H6/c1-8-4-6-20(15)7-10(8)19(2)12-9-3-5-16-11(9)17-13(14)18-12;1-2/h3,5,8,10H,4,6-7,15H2,1-2H3,(H,16,17,18);1-2H3 |
| InChIKey | JEUGBHDJCSEJHD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|