C11H20O3 — CID 144658267
(4aS,6R)-2-methoxy-4,6-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 144658267) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4aS,6R)-2-methoxy-4,6-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (4aS,6R)-2-methoxy-4,6-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 144658267 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4aS,6R)-2-methoxy-4,6-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | COC1CC(C)[C@@H]2O[C@H](C)CCC2O1 |
| InChI | InChI=1S/C11H20O3/c1-7-6-10(12-3)14-9-5-4-8(2)13-11(7)9/h7-11H,4-6H2,1-3H3/t7?,8-,9?,10?,11+/m1/s1 |
| InChIKey | FSRJRAPTTXEPRR-OBELEAIMSA-N |
| XLogP | 1.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |