About (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne
(3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne (PubChem CID 144658378) has the molecular formula C11H15FS
and a molecular weight of 198.31 g/mol. Its IUPAC name is (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne.
Molecular Properties
| Compound Name | (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne |
| PubChem CID | 144658378 |
| Molecular Formula | C11H15FS |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne |
| SMILES | C#CC/C(F)=C(\C=C)CSCCC |
| InChI | InChI=1S/C11H15FS/c1-4-7-11(12)10(6-3)9-13-8-5-2/h1,6H,3,5,7-9H2,2H3/b11-10- |
| InChIKey | SZHOOQJVBGLXPM-KHPPLWFESA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne?
The IUPAC name of (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne (CID 144658378) is (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne.
What is the SMILES notation for (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne?
The canonical SMILES for (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne is C#CC/C(F)=C(\C=C)CSCCC.
What is the InChIKey of (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne?
The InChIKey is SZHOOQJVBGLXPM-KHPPLWFESA-N. The full InChI is InChI=1S/C11H15FS/c1-4-7-11(12)10(6-3)9-13-8-5-2/h1,6H,3,5,7-9H2,2H3/b11-10-.
What are the key properties of (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne?
(3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne has a molecular weight of 198.31 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-fluoro-3-(propylsulfanylmethyl)hepta-1,3-dien-6-yne is sourced from PubChem (CID 144658378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).