C36H33NO7 — CID 14465869
[(3aS,4R,5S,6S,7aS)-5-benzoyloxy-3-benzyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl benzoate (PubChem CID 14465869) has the molecular formula C36H33NO7 and a molecular weight of 591.66 g/mol. Its IUPAC name is [(3aS,4R,5S,6S,7aS)-5-benzoyloxy-3-benzyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl benzoate.
| Compound Name | [(3aS,4R,5S,6S,7aS)-5-benzoyloxy-3-benzyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 14465869 |
| Molecular Formula | C36H33NO7 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | [(3aS,4R,5S,6S,7aS)-5-benzoyloxy-3-benzyl-2-oxo-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl benzoate |
| SMILES | O=C(OCC1C[C@@H]2OC(=O)N(Cc3ccccc3)[C@@H]2[C@@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H33NO7/c38-34(27-17-9-3-10-18-27)42-24-29-21-30-31(37(36(40)43-30)22-25-13-5-1-6-14-25)33(41-23-26-15-7-2-8-16-26)32(29)44-35(39)28-19-11-4-12-20-28/h1-20,29-33H,21-24H2/t29?,30-,31-,32-,33+/m0/s1 |
| InChIKey | PGIHGJCBRAMVJC-DDCZRWHQSA-N |
| XLogP | 6.06 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|