About 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride
4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride (PubChem CID 144659251) has the molecular formula C7H9FN2O3
and a molecular weight of 188.16 g/mol. Its IUPAC name is 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride.
Molecular Properties
| Compound Name | 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride |
| PubChem CID | 144659251 |
| Molecular Formula | C7H9FN2O3 |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride |
| SMILES | CCN1CCN(C(=O)F)C(=O)C1=O |
| InChI | InChI=1S/C7H9FN2O3/c1-2-9-3-4-10(7(8)13)6(12)5(9)11/h2-4H2,1H3 |
| InChIKey | QCFZMNJKTGCCCF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride?
The IUPAC name of 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride (CID 144659251) is 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride.
What is the SMILES notation for 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride?
The canonical SMILES for 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride is CCN1CCN(C(=O)F)C(=O)C1=O.
What is the InChIKey of 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride?
The InChIKey is QCFZMNJKTGCCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O3/c1-2-9-3-4-10(7(8)13)6(12)5(9)11/h2-4H2,1H3.
What are the key properties of 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride?
4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride has a molecular weight of 188.16 g/mol, XLogP of -0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3-dioxopiperazine-1-carbonyl fluoride is sourced from PubChem (CID 144659251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).