C19H29N5O3 — CID 144659480
1-amino-3-[2-[(4-ethanimidoyl-2-methylphenoxy)methyl]phenyl]-1-methylurea;azane;methanol (PubChem CID 144659480) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-amino-3-[2-[(4-ethanimidoyl-2-methylphenoxy)methyl]phenyl]-1-methylurea;azane;methanol.
| Compound Name | 1-amino-3-[2-[(4-ethanimidoyl-2-methylphenoxy)methyl]phenyl]-1-methylurea;azane;methanol |
|---|---|
| PubChem CID | 144659480 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-amino-3-[2-[(4-ethanimidoyl-2-methylphenoxy)methyl]phenyl]-1-methylurea;azane;methanol |
| SMILES | CO.N.[H]/N=C(\C)c1ccc(OCc2ccccc2NC(=O)N(C)N)c(C)c1 |
| InChI | InChI=1S/C18H22N4O2.CH4O.H3N/c1-12-10-14(13(2)19)8-9-17(12)24-11-15-6-4-5-7-16(15)21-18(23)22(3)20;1-2;/h4-10,19H,11,20H2,1-3H3,(H,21,23);2H,1H3;1H3/b19-13+;; |
| InChIKey | DUMFDAVLUQZVDO-BWSKXRJVSA-N |
| XLogP | 3.07 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|