C19H18 — CID 144659950
9-methyl-3,4,5,6-tetrahydrochrysene (PubChem CID 144659950) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is 9-methyl-3,4,5,6-tetrahydrochrysene.
| Compound Name | 9-methyl-3,4,5,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 144659950 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 9-methyl-3,4,5,6-tetrahydrochrysene |
| SMILES | Cc1ccc2c(c1)-c1ccc3c(c1CC2)CCC=C3 |
| InChI | InChI=1S/C19H18/c1-13-6-7-15-9-10-17-16-5-3-2-4-14(16)8-11-18(17)19(15)12-13/h2,4,6-8,11-12H,3,5,9-10H2,1H3 |
| InChIKey | KPOODECWWBIERF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |