C37H37N5 — CID 144660218
2-[(2E,4Z)-5-amino-5-(4,6-dinaphthalen-2-yl-1,3,5-triazinan-2-yl)penta-2,4-dien-2-yl]-6-[(Z)-prop-1-enyl]aniline (PubChem CID 144660218) has the molecular formula C37H37N5 and a molecular weight of 551.74 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-amino-5-(4,6-dinaphthalen-2-yl-1,3,5-triazinan-2-yl)penta-2,4-dien-2-yl]-6-[(Z)-prop-1-enyl]aniline.
| Compound Name | 2-[(2E,4Z)-5-amino-5-(4,6-dinaphthalen-2-yl-1,3,5-triazinan-2-yl)penta-2,4-dien-2-yl]-6-[(Z)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 144660218 |
| Molecular Formula | C37H37N5 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 2-[(2E,4Z)-5-amino-5-(4,6-dinaphthalen-2-yl-1,3,5-triazinan-2-yl)penta-2,4-dien-2-yl]-6-[(Z)-prop-1-enyl]aniline |
| SMILES | C/C=C\c1cccc(/C(C)=C/C=C(\N)C2NC(c3ccc4ccccc4c3)NC(c3ccc4ccccc4c3)N2)c1N |
| InChI | InChI=1S/C37H37N5/c1-3-9-27-14-8-15-32(34(27)39)24(2)16-21-33(38)37-41-35(30-19-17-25-10-4-6-12-28(25)22-30)40-36(42-37)31-20-18-26-11-5-7-13-29(26)23-31/h3-23,35-37,40-42H,38-39H2,1-2H3/b9-3-,24-16+,33-21- |
| InChIKey | GDNUXOMHWOOLGR-VQGNQWQTSA-N |
| XLogP | 7.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|