C40H32N4+2 — CID 144660253
(Z)-2-[5-[4,6-di(phenanthren-9-yl)-1,2-dihydropyrimidin-1-ium-2-yl]-2H-pyrrol-1-ium-2-yl]but-2-en-1-imine (PubChem CID 144660253) has the molecular formula C40H32N4+2 and a molecular weight of 568.72 g/mol. Its IUPAC name is (Z)-2-[5-[4,6-di(phenanthren-9-yl)-1,2-dihydropyrimidin-1-ium-2-yl]-2H-pyrrol-1-ium-2-yl]but-2-en-1-imine.
| Compound Name | (Z)-2-[5-[4,6-di(phenanthren-9-yl)-1,2-dihydropyrimidin-1-ium-2-yl]-2H-pyrrol-1-ium-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 144660253 |
| Molecular Formula | C40H32N4+2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (Z)-2-[5-[4,6-di(phenanthren-9-yl)-1,2-dihydropyrimidin-1-ium-2-yl]-2H-pyrrol-1-ium-2-yl]but-2-en-1-imine |
| SMILES | [H]/N=C/C(=C\C)C1C=CC(C2N=C(c3cc4ccccc4c4ccccc34)C=C(c3cc4ccccc4c4ccccc34)[NH2+]2)=[NH+]1 |
| InChI | InChI=1S/C40H30N4/c1-2-25(24-41)36-19-20-37(42-36)40-43-38(34-21-26-11-3-5-13-28(26)30-15-7-9-17-32(30)34)23-39(44-40)35-22-27-12-4-6-14-29(27)31-16-8-10-18-33(31)35/h2-24,36,40-41,43H,1H3/p+2/b25-2+,41-24+ |
| InChIKey | SUMDILFKXDJSGI-WENDOLPWSA-P |
| XLogP | 6.09 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|