C26H33NOS — CID 144661565
3-methoxy-2,3-dimethylbutane-2-thiol;7-methyl-9-phenyl-4a,9a-dihydrocarbazole (PubChem CID 144661565) has the molecular formula C26H33NOS and a molecular weight of 407.62 g/mol. Its IUPAC name is 3-methoxy-2,3-dimethylbutane-2-thiol;7-methyl-9-phenyl-4a,9a-dihydrocarbazole.
| Compound Name | 3-methoxy-2,3-dimethylbutane-2-thiol;7-methyl-9-phenyl-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 144661565 |
| Molecular Formula | C26H33NOS |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-methoxy-2,3-dimethylbutane-2-thiol;7-methyl-9-phenyl-4a,9a-dihydrocarbazole |
| SMILES | COC(C)(C)C(C)(C)S.Cc1ccc2c(c1)N(c1ccccc1)C1C=CC=CC21 |
| InChI | InChI=1S/C19H17N.C7H16OS/c1-14-11-12-17-16-9-5-6-10-18(16)20(19(17)13-14)15-7-3-2-4-8-15;1-6(2,8-5)7(3,4)9/h2-13,16,18H,1H3;9H,1-5H3 |
| InChIKey | HTSXVXXDTVBQKP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|