C44H33N3S — CID 144661705
14-(4,6-diphenyl-2-pyridinyl)-20-[(3E,5Z)-hepta-3,5-dien-3-yl]-10-thia-14,20-diazahexacyclo[11.10.0.03,11.04,9.015,23.017,21]tricosa-1(13),2,4,6,8,11,15(23),16,18,21-decaene (PubChem CID 144661705) has the molecular formula C44H33N3S and a molecular weight of 635.84 g/mol. Its IUPAC name is 14-(4,6-diphenyl-2-pyridinyl)-20-[(3E,5Z)-hepta-3,5-dien-3-yl]-10-thia-14,20-diazahexacyclo[11.10.0.03,11.04,9.015,23.017,21]tricosa-1(13),2,4,6,8,11,15(23),16,18,21-decaene.
| Compound Name | 14-(4,6-diphenyl-2-pyridinyl)-20-[(3E,5Z)-hepta-3,5-dien-3-yl]-10-thia-14,20-diazahexacyclo[11.10.0.03,11.04,9.015,23.017,21]tricosa-1(13),2,4,6,8,11,15(23),16,18,21-decaene |
|---|---|
| PubChem CID | 144661705 |
| Molecular Formula | C44H33N3S |
| Molecular Weight | 635.84 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | 14-(4,6-diphenyl-2-pyridinyl)-20-[(3E,5Z)-hepta-3,5-dien-3-yl]-10-thia-14,20-diazahexacyclo[11.10.0.03,11.04,9.015,23.017,21]tricosa-1(13),2,4,6,8,11,15(23),16,18,21-decaene |
| SMILES | C/C=C\C=C(/CC)n1ccc2cc3c(cc21)c1cc2c(cc1n3-c1cc(-c3ccccc3)cc(-c3ccccc3)n1)sc1ccccc12 |
| InChI | InChI=1S/C44H33N3S/c1-3-5-18-33(4-2)46-22-21-31-24-40-36(27-39(31)46)35-26-37-34-19-12-13-20-42(34)48-43(37)28-41(35)47(40)44-25-32(29-14-8-6-9-15-29)23-38(45-44)30-16-10-7-11-17-30/h3,5-28H,4H2,1-2H3/b5-3-,33-18+ |
| InChIKey | JWEMCHZAPOFXJM-KCKFDWFNSA-N |
| XLogP | 12.66 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.84 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|