C19H28O6 — CID 14466190
[(2Z,6Z)-6-(acetyloxymethyl)-8-hydroxy-2-[(E)-4-methyl-5-oxopent-3-enyl]octa-2,6-dienyl] acetate (PubChem CID 14466190) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(2Z,6Z)-6-(acetyloxymethyl)-8-hydroxy-2-[(E)-4-methyl-5-oxopent-3-enyl]octa-2,6-dienyl] acetate.
| Compound Name | [(2Z,6Z)-6-(acetyloxymethyl)-8-hydroxy-2-[(E)-4-methyl-5-oxopent-3-enyl]octa-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 14466190 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(2Z,6Z)-6-(acetyloxymethyl)-8-hydroxy-2-[(E)-4-methyl-5-oxopent-3-enyl]octa-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C(=C\CO)CC/C=C(/CC/C=C(\C)C=O)COC(C)=O |
| InChI | InChI=1S/C19H28O6/c1-15(12-21)6-4-7-18(13-24-16(2)22)8-5-9-19(10-11-20)14-25-17(3)23/h6,8,10,12,20H,4-5,7,9,11,13-14H2,1-3H3/b15-6+,18-8-,19-10- |
| InChIKey | NYCFYGOJSIWKPN-BVNZSQIGSA-N |
| XLogP | 2.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|