2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen

C11H21N3 — CID 144662329

IUPAC2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen
SMILESC1=Cc2n[nH]nc2C=CC1.CC.CC.[H][H]
InChIInChI=1S/C7H7N3.2C2H6.H2/c1-2-4-6-7(5-3-1)9-10-8-6;2*1-2;/h2-5H,1H2,(H,8,9,10);2*1-2H3;1H
InChIKeyKVSHQKFKNOHAIZ-UHFFFAOYSA-N
MW195.31 g/mol
LogP3.53
Rot. Bonds

About 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen

2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen (PubChem CID 144662329) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen.

Molecular Properties

Compound Name2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen
PubChem CID144662329
Molecular FormulaC11H21N3
Molecular Weight195.31 g/mol
Exact Mass195.17
IUPAC Name2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen
SMILESC1=Cc2n[nH]nc2C=CC1.CC.CC.[H][H]
InChIInChI=1S/C7H7N3.2C2H6.H2/c1-2-4-6-7(5-3-1)9-10-8-6;2*1-2;/h2-5H,1H2,(H,8,9,10);2*1-2H3;1H
InChIKeyKVSHQKFKNOHAIZ-UHFFFAOYSA-N
XLogP3.53
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.31
LogP ≤ 53.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen?
The IUPAC name of 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen (CID 144662329) is 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen.
What is the SMILES notation for 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen?
The canonical SMILES for 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen is C1=Cc2n[nH]nc2C=CC1.CC.CC.[H][H].
What is the InChIKey of 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen?
The InChIKey is KVSHQKFKNOHAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.2C2H6.H2/c1-2-4-6-7(5-3-1)9-10-8-6;2*1-2;/h2-5H,1H2,(H,8,9,10);2*1-2H3;1H.
What are the key properties of 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen?
2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen has a molecular weight of 195.31 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dihydrocyclohepta[d]triazole;ethane;molecular hydrogen is sourced from PubChem (CID 144662329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).