About 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine
1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine (PubChem CID 144662380) has the molecular formula C11H21F3N2
and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine |
| PubChem CID | 144662380 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine |
| SMILES | CC(C)NC1(CN(C)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2/c1-9(2)15-10(4-5-10)8-16(3)7-6-11(12,13)14/h9,15H,4-8H2,1-3H3 |
| InChIKey | DEQUTLOIGYFRAE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine?
The IUPAC name of 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine (CID 144662380) is 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine.
What is the SMILES notation for 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine?
The canonical SMILES for 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine is CC(C)NC1(CN(C)CCC(F)(F)F)CC1.
What is the InChIKey of 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine?
The InChIKey is DEQUTLOIGYFRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2/c1-9(2)15-10(4-5-10)8-16(3)7-6-11(12,13)14/h9,15H,4-8H2,1-3H3.
What are the key properties of 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine?
1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine has a molecular weight of 238.30 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[methyl(3,3,3-trifluoropropyl)amino]methyl]-N-propan-2-ylcyclopropan-1-amine is sourced from PubChem (CID 144662380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).