About N,N-dimethyl-3,4-dihydropyridin-2-amine
N,N-dimethyl-3,4-dihydropyridin-2-amine (PubChem CID 144662400) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N,N-dimethyl-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3,4-dihydropyridin-2-amine |
| PubChem CID | 144662400 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,N-dimethyl-3,4-dihydropyridin-2-amine |
| SMILES | CN(C)C1=NC=CCC1 |
| InChI | InChI=1S/C7H12N2/c1-9(2)7-5-3-4-6-8-7/h4,6H,3,5H2,1-2H3 |
| InChIKey | KDZCVGGRVJBQLH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3,4-dihydropyridin-2-amine?
The IUPAC name of N,N-dimethyl-3,4-dihydropyridin-2-amine (CID 144662400) is N,N-dimethyl-3,4-dihydropyridin-2-amine.
What is the SMILES notation for N,N-dimethyl-3,4-dihydropyridin-2-amine?
The canonical SMILES for N,N-dimethyl-3,4-dihydropyridin-2-amine is CN(C)C1=NC=CCC1.
What is the InChIKey of N,N-dimethyl-3,4-dihydropyridin-2-amine?
The InChIKey is KDZCVGGRVJBQLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-9(2)7-5-3-4-6-8-7/h4,6H,3,5H2,1-2H3.
What are the key properties of N,N-dimethyl-3,4-dihydropyridin-2-amine?
N,N-dimethyl-3,4-dihydropyridin-2-amine has a molecular weight of 124.19 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 144662400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).