About N,8-dimethyl-N,3-dipropylquinolin-2-amine
N,8-dimethyl-N,3-dipropylquinolin-2-amine (PubChem CID 144663583) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is N,8-dimethyl-N,3-dipropylquinolin-2-amine.
Molecular Properties
| Compound Name | N,8-dimethyl-N,3-dipropylquinolin-2-amine |
| PubChem CID | 144663583 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N,8-dimethyl-N,3-dipropylquinolin-2-amine |
| SMILES | CCCc1cc2cccc(C)c2nc1N(C)CCC |
| InChI | InChI=1S/C17H24N2/c1-5-8-15-12-14-10-7-9-13(3)16(14)18-17(15)19(4)11-6-2/h7,9-10,12H,5-6,8,11H2,1-4H3 |
| InChIKey | KCGXBLCHXBKMDK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,8-dimethyl-N,3-dipropylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,8-dimethyl-N,3-dipropylquinolin-2-amine?
The IUPAC name of N,8-dimethyl-N,3-dipropylquinolin-2-amine (CID 144663583) is N,8-dimethyl-N,3-dipropylquinolin-2-amine.
What is the SMILES notation for N,8-dimethyl-N,3-dipropylquinolin-2-amine?
The canonical SMILES for N,8-dimethyl-N,3-dipropylquinolin-2-amine is CCCc1cc2cccc(C)c2nc1N(C)CCC.
What is the InChIKey of N,8-dimethyl-N,3-dipropylquinolin-2-amine?
The InChIKey is KCGXBLCHXBKMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-5-8-15-12-14-10-7-9-13(3)16(14)18-17(15)19(4)11-6-2/h7,9-10,12H,5-6,8,11H2,1-4H3.
What are the key properties of N,8-dimethyl-N,3-dipropylquinolin-2-amine?
N,8-dimethyl-N,3-dipropylquinolin-2-amine has a molecular weight of 256.39 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,8-dimethyl-N,3-dipropylquinolin-2-amine is sourced from PubChem (CID 144663583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).