C12H15FO4 — CID 144663607
fluoro (4E,6Z)-4-[(E)-1-methoxyprop-1-enyl]-3-oxoocta-4,6-dienoate (PubChem CID 144663607) has the molecular formula C12H15FO4 and a molecular weight of 242.25 g/mol. Its IUPAC name is fluoro (4E,6Z)-4-[(E)-1-methoxyprop-1-enyl]-3-oxoocta-4,6-dienoate.
| Compound Name | fluoro (4E,6Z)-4-[(E)-1-methoxyprop-1-enyl]-3-oxoocta-4,6-dienoate |
|---|---|
| PubChem CID | 144663607 |
| Molecular Formula | C12H15FO4 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | fluoro (4E,6Z)-4-[(E)-1-methoxyprop-1-enyl]-3-oxoocta-4,6-dienoate |
| SMILES | C/C=C\C=C(C(=O)CC(=O)OF)/C(=C\C)OC |
| InChI | InChI=1S/C12H15FO4/c1-4-6-7-9(11(5-2)16-3)10(14)8-12(15)17-13/h4-7H,8H2,1-3H3/b6-4-,9-7-,11-5+ |
| InChIKey | WAASCUCRVPGEEV-VZVYMQBCSA-N |
| XLogP | 2.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|