About ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one
ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one (PubChem CID 144663698) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one.
Molecular Properties
| Compound Name | ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one |
| PubChem CID | 144663698 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one |
| SMILES | CC.Cc1[nH]c(C)c([N+](=O)[O-])c(=O)c1C |
| InChI | InChI=1S/C8H10N2O3.C2H6/c1-4-5(2)9-6(3)7(8(4)11)10(12)13;1-2/h1-3H3,(H,9,11);1-2H3 |
| InChIKey | IBRGLKKHUMYUFQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one?
The IUPAC name of ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one (CID 144663698) is ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one.
What is the SMILES notation for ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one?
The canonical SMILES for ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one is CC.Cc1[nH]c(C)c([N+](=O)[O-])c(=O)c1C.
What is the InChIKey of ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one?
The InChIKey is IBRGLKKHUMYUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3.C2H6/c1-4-5(2)9-6(3)7(8(4)11)10(12)13;1-2/h1-3H3,(H,9,11);1-2H3.
What are the key properties of ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one?
ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one has a molecular weight of 212.25 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,3,6-trimethyl-5-nitro-1H-pyridin-4-one is sourced from PubChem (CID 144663698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).