C29H45BO7S — CID 144663816
butyl 3-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate (PubChem CID 144663816) has the molecular formula C29H45BO7S and a molecular weight of 548.55 g/mol. Its IUPAC name is butyl 3-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate.
| Compound Name | butyl 3-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 144663816 |
| Molecular Formula | C29H45BO7S |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | butyl 3-[[4,5-dimethyl-4-(2,2,3-trimethylcyclobutyl)-1,3,2-dioxaborolan-2-yl]methyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate |
| SMILES | CCCCOC(=O)c1c(SC)ccc(CB2OC(C)C(C)(C3CC(C)C3(C)C)O2)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H45BO7S/c1-11-12-15-33-25(31)23-21(38-10)14-13-20(24(23)34-26(32)35-27(4,5)6)17-30-36-19(3)29(9,37-30)22-16-18(2)28(22,7)8/h13-14,18-19,22H,11-12,15-17H2,1-10H3 |
| InChIKey | CNZXTWSRAGRFCX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|