About N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine
N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine (PubChem CID 144664445) has the molecular formula C14H18FNO
and a molecular weight of 235.30 g/mol. Its IUPAC name is N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 144664445 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine |
| SMILES | COC1=C(NC2=CCC(F)C=C2)C=CCC1C |
| InChI | InChI=1S/C14H18FNO/c1-10-4-3-5-13(14(10)17-2)16-12-8-6-11(15)7-9-12/h3,5-6,8-11,16H,4,7H2,1-2H3 |
| InChIKey | KDGDKAQNYSXUSJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine (CID 144664445) is N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine is COC1=C(NC2=CCC(F)C=C2)C=CCC1C.
What is the InChIKey of N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is KDGDKAQNYSXUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO/c1-10-4-3-5-13(14(10)17-2)16-12-8-6-11(15)7-9-12/h3,5-6,8-11,16H,4,7H2,1-2H3.
What are the key properties of N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine?
N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 235.30 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorocyclohexa-1,5-dien-1-yl)-2-methoxy-3-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 144664445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).