C13H23NO — CID 144664449
(3Z,5Z)-7-methoxy-2-methyl-5-propan-2-ylocta-3,5,7-trien-4-amine (PubChem CID 144664449) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (3Z,5Z)-7-methoxy-2-methyl-5-propan-2-ylocta-3,5,7-trien-4-amine.
| Compound Name | (3Z,5Z)-7-methoxy-2-methyl-5-propan-2-ylocta-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 144664449 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3Z,5Z)-7-methoxy-2-methyl-5-propan-2-ylocta-3,5,7-trien-4-amine |
| SMILES | C=C(/C=C(C(\N)=C\C(C)C)/C(C)C)OC |
| InChI | InChI=1S/C13H23NO/c1-9(2)7-13(14)12(10(3)4)8-11(5)15-6/h7-10H,5,14H2,1-4,6H3/b12-8-,13-7- |
| InChIKey | XAOZSFICNWTATD-SVGXSMIJSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|