About (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane
(E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane (PubChem CID 144664576) has the molecular formula C15H22ClNO
and a molecular weight of 267.80 g/mol. Its IUPAC name is (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane.
Molecular Properties
| Compound Name | (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane |
| PubChem CID | 144664576 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane |
| SMILES | CC.Cc1ccc(N(C)CC/C=C(/Cl)C=O)cc1 |
| InChI | InChI=1S/C13H16ClNO.C2H6/c1-11-5-7-13(8-6-11)15(2)9-3-4-12(14)10-16;1-2/h4-8,10H,3,9H2,1-2H3;1-2H3/b12-4+; |
| InChIKey | DZCWLDOLBAMRJK-AQCBZIOHSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane?
The IUPAC name of (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane (CID 144664576) is (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane.
What is the SMILES notation for (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane?
The canonical SMILES for (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane is CC.Cc1ccc(N(C)CC/C=C(/Cl)C=O)cc1.
What is the InChIKey of (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane?
The InChIKey is DZCWLDOLBAMRJK-AQCBZIOHSA-N. The full InChI is InChI=1S/C13H16ClNO.C2H6/c1-11-5-7-13(8-6-11)15(2)9-3-4-12(14)10-16;1-2/h4-8,10H,3,9H2,1-2H3;1-2H3/b12-4+;.
What are the key properties of (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane?
(E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane has a molecular weight of 267.80 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-chloro-5-(N,4-dimethylanilino)pent-2-enal;ethane is sourced from PubChem (CID 144664576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).