About 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 14466463) has the molecular formula C7H13NO3S
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 14466463 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SC(CO)NC1C(=O)O |
| InChI | InChI=1S/C7H13NO3S/c1-7(2)5(6(10)11)8-4(3-9)12-7/h4-5,8-9H,3H2,1-2H3,(H,10,11) |
| InChIKey | IUDYPSDWEFGLQG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CID 14466463) is 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid is CC1(C)SC(CO)NC1C(=O)O.
What is the InChIKey of 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is IUDYPSDWEFGLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3S/c1-7(2)5(6(10)11)8-4(3-9)12-7/h4-5,8-9H,3H2,1-2H3,(H,10,11).
What are the key properties of 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 191.25 g/mol, XLogP of -0.13, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 14466463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).