C23H25NO5 — CID 144664808
(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole (PubChem CID 144664808) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole.
| Compound Name | (3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 144664808 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@@H]3OC(c4ccccc4)=N[C@@H]3[C@@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H25NO5/c1-23(2)26-14-17(29-23)19-20(25-13-15-9-5-3-6-10-15)18-22(27-19)28-21(24-18)16-11-7-4-8-12-16/h3-12,17-20,22H,13-14H2,1-2H3/t17-,18-,19-,20+,22-/m1/s1 |
| InChIKey | DVJWIAFSQBCWAE-MMXRJIGESA-N |
| XLogP | 3.29 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |