About 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane
4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane (PubChem CID 144664961) has the molecular formula C13H23F2N3O
and a molecular weight of 275.34 g/mol. Its IUPAC name is 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane.
Molecular Properties
| Compound Name | 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane |
| PubChem CID | 144664961 |
| Molecular Formula | C13H23F2N3O |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane |
| SMILES | CC.Cc1ccn(CC(F)(F)CN2CCOCC2)n1 |
| InChI | InChI=1S/C11H17F2N3O.C2H6/c1-10-2-3-16(14-10)9-11(12,13)8-15-4-6-17-7-5-15;1-2/h2-3H,4-9H2,1H3;1-2H3 |
| InChIKey | ZWMIWESXPWTQMC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane?
The IUPAC name of 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane (CID 144664961) is 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane.
What is the SMILES notation for 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane?
The canonical SMILES for 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane is CC.Cc1ccn(CC(F)(F)CN2CCOCC2)n1.
What is the InChIKey of 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane?
The InChIKey is ZWMIWESXPWTQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3O.C2H6/c1-10-2-3-16(14-10)9-11(12,13)8-15-4-6-17-7-5-15;1-2/h2-3H,4-9H2,1H3;1-2H3.
What are the key properties of 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane?
4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane has a molecular weight of 275.34 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoro-3-(3-methylpyrazol-1-yl)propyl]morpholine;ethane is sourced from PubChem (CID 144664961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).