About ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine
ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine (PubChem CID 144665861) has the molecular formula C11H26N2O
and a molecular weight of 202.34 g/mol. Its IUPAC name is ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine |
| PubChem CID | 144665861 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine |
| SMILES | CC.COCCCN/C=C(/C)C(C)N |
| InChI | InChI=1S/C9H20N2O.C2H6/c1-8(9(2)10)7-11-5-4-6-12-3;1-2/h7,9,11H,4-6,10H2,1-3H3;1-2H3/b8-7-; |
| InChIKey | CDJABLIAFKBUBU-CFYXSCKTSA-N |
| XLogP | 1.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine?
The IUPAC name of ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine (CID 144665861) is ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine.
What is the SMILES notation for ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine?
The canonical SMILES for ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine is CC.COCCCN/C=C(/C)C(C)N.
What is the InChIKey of ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine?
The InChIKey is CDJABLIAFKBUBU-CFYXSCKTSA-N. The full InChI is InChI=1S/C9H20N2O.C2H6/c1-8(9(2)10)7-11-5-4-6-12-3;1-2/h7,9,11H,4-6,10H2,1-3H3;1-2H3/b8-7-;.
What are the key properties of ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine?
ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine has a molecular weight of 202.34 g/mol, XLogP of 1.89, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-1-N-(3-methoxypropyl)-2-methylbut-1-ene-1,3-diamine is sourced from PubChem (CID 144665861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).